
CAS 1261911-13-0
:3′-Chloro-4′-fluoro-5-methyl[1,1′-biphenyl]-3-ol
Description:
3′-Chloro-4′-fluoro-5-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position of one of the phenyl rings indicates that it is a phenolic compound, which can exhibit properties such as antioxidant activity and potential applications in pharmaceuticals. The chlorine and fluorine substituents at the 3′ and 4′ positions, respectively, contribute to the compound's unique reactivity and may influence its biological activity, solubility, and stability. The methyl group at the 5-position adds to the compound's steric and electronic properties. Overall, this compound's specific functional groups and substituents suggest potential utility in various chemical applications, including medicinal chemistry and materials science. However, detailed studies would be necessary to fully understand its behavior and potential uses in different contexts.
Formula:C13H10ClFO
InChI:InChI=1S/C13H10ClFO/c1-8-4-10(6-11(16)5-8)9-2-3-13(15)12(14)7-9/h2-7,16H,1H3
InChI key:InChIKey=NPNBADQZYJJJNO-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(O)C1)C2=CC(Cl)=C(F)C=C2
Synonyms:- 3′-Chloro-4′-fluoro-5-methyl[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 3′-chloro-4′-fluoro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.