CymitQuimica logo

CAS 1261911-18-5

:

2′,4′,5-Trichloro[1,1′-biphenyl]-3-carboxylic acid

Description:
2′,4′,5-Trichloro[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 1261911-18-5, is a chlorinated aromatic compound characterized by the presence of three chlorine atoms and a carboxylic acid functional group attached to a biphenyl structure. This compound typically exhibits low solubility in water due to its hydrophobic biphenyl backbone, while being more soluble in organic solvents. The chlorination pattern contributes to its chemical stability and potential bioaccumulation in environmental contexts. It may exhibit various biological activities, including potential toxicity to aquatic organisms, which raises concerns regarding its environmental impact. The presence of the carboxylic acid group allows for potential reactivity in various chemical reactions, including esterification and amidation. Overall, this compound is of interest in studies related to environmental chemistry, toxicology, and the development of analytical methods for detecting chlorinated pollutants.
Formula:C13H7Cl3O2
InChI:InChI=1S/C13H7Cl3O2/c14-9-1-2-11(12(16)6-9)7-3-8(13(17)18)5-10(15)4-7/h1-6H,(H,17,18)
InChI key:InChIKey=BTQGANSTEJPECJ-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(C(O)=O)=CC(Cl)=C2)C=CC(Cl)=C1
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′,4′,5-trichloro-
  • 2′,4′,5-Trichloro[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.