CAS 1261911-48-1

Methyl 2-fluoro-3′-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 2-fluoro-3′-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxylate is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group and a fluoro substituent on the biphenyl framework contributes to its unique chemical properties, including potential variations in polarity and reactivity. The hydroxyl group (-OH) at the 3′ position enhances its hydrogen bonding capabilities, which can influence solubility in polar solvents. The carboxylate ester functional group (-COOCH3) at the 4 position suggests that this compound may participate in esterification reactions and could be hydrolyzed under certain conditions. Its fluorine atom may impart specific electronic effects, potentially affecting the compound's biological activity or interaction with other molecules. Overall, this compound may be of interest in fields such as medicinal chemistry or materials science, where modifications to biphenyl derivatives can lead to novel properties or applications.

Formula: C₁₅H₁₃FO₃

InChI: InChI=1S/C15H13FO3/c1-9-3-4-10(8-14(9)17)12-6-5-11(7-13(12)16)15(18)19-2/h3-8,17H,1-2H3

InChI key: InChIKey=VIZRLRNOHWNWFT-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(O)=C(C)C=C2)C=CC(C(OC)=O)=C1

Synonyms:

• Methyl 2-fluoro-3′-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxylate
• [1,1′-Biphenyl]-4-carboxylic acid, 2-fluoro-3′-hydroxy-4′-methyl-, methyl ester