CAS 1261911-66-3

3′-Methyl 5′-fluoro-4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate

Description:

3′-Methyl 5′-fluoro-4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methyl group at the 3′ position, a fluorine atom at the 5′ position, and a methoxy group at the 4 position of one of the phenyl rings. Additionally, it contains two carboxylate ester functionalities at the 2 and 3′ positions, contributing to its reactivity and potential applications in various chemical reactions. The presence of the fluorine atom can enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. The methoxy group may also influence the compound's solubility and electronic properties. Overall, this compound's unique structural features suggest potential utility in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific applications would depend on further research and characterization.

Formula: C₁₆H₁₃FO₅

InChI: InChI=1S/C16H13FO5/c1-21-12-3-4-13(14(8-12)15(18)19)9-5-10(16(20)22-2)7-11(17)6-9/h3-8H,1-2H3,(H,18,19)

InChI key: InChIKey=LQLXRTJTUHIOSD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(OC)=C1)C2=CC(C(OC)=O)=CC(F)=C2

Synonyms:

• 3′-Methyl 5′-fluoro-4-methoxy[1,1′-biphenyl]-2,3′-dicarboxylate
• [1,1′-Biphenyl]-2,3′-dicarboxylic acid, 5′-fluoro-4-methoxy-, 3′-methyl ester