CymitQuimica logo

CAS 1261911-72-1

:

2-(4-Fluoro-3-methylphenyl)-3-pyridinecarboxylic acid

Description:
2-(4-Fluoro-3-methylphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its distinct chemical properties and potential biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while the carboxylic acid group may enhance its solubility in polar solvents. The fluorine substituent can influence the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific melting and boiling points, which are important for its characterization and application in various chemical processes. Its potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and chemical reactivity. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C13H10FNO2
InChI:InChI=1S/C13H10FNO2/c1-8-7-9(4-5-11(8)14)12-10(13(16)17)3-2-6-15-12/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=VANHEADGCDMMJN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)C2=CC(C)=C(F)C=C2
Synonyms:
  • 2-(4-Fluoro-3-methylphenyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-(4-fluoro-3-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.