
CAS 1261911-77-6
:3-(5-Fluoro-2-methylphenyl)-4-pyridinecarboxylic acid
Description:
3-(5-Fluoro-2-methylphenyl)-4-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its distinct chemical properties and potential biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic components may impart some hydrophobic characteristics. The fluorine substitution can enhance lipophilicity and influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions typical of carboxylic acids, such as esterification or amidation. Its specific applications and reactivity would depend on further studies, particularly in the context of drug development or material science. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.
Formula:C13H10FNO2
InChI:InChI=1S/C13H10FNO2/c1-8-2-3-9(14)6-11(8)12-7-15-5-4-10(12)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=UYGRXYOVBGPCFK-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=C(C)C=CC(F)=C2
Synonyms:- 3-(5-Fluoro-2-methylphenyl)-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 3-(5-fluoro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.