CAS 1261911-94-7

5-Nitro-2′-(phenylmethoxy)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Nitro-2′-(phenylmethoxy)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a nitro group, a phenylmethoxy group, and a carboxylic acid functional group. This compound belongs to the class of biphenyl derivatives, which are known for their diverse applications in organic synthesis and material science. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and polarity. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can enhance solubility in polar solvents. Additionally, the phenylmethoxy moiety can affect the compound's lipophilicity and overall stability. Such structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's specific properties, such as melting point, solubility, and reactivity, would require empirical data for precise characterization, but its functional groups indicate a versatile chemical behavior.

Formula: C₂₀H₁₅NO₅

InChI: InChI=1S/C20H15NO5/c22-20(23)16-10-15(11-17(12-16)21(24)25)18-8-4-5-9-19(18)26-13-14-6-2-1-3-7-14/h1-12H,13H2,(H,22,23)

InChI key: InChIKey=JORRZAHJWSAAIL-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(C=CC=C2)C3=CC(C(O)=O)=CC(N(=O)=O)=C3

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-nitro-2′-(phenylmethoxy)-
• 5-Nitro-2′-(phenylmethoxy)[1,1′-biphenyl]-3-carboxylic acid