CymitQuimica logo

CAS 1261911-98-1

:

5-(3-Fluoro-5-hydroxyphenyl)-3-pyridinecarboxylic acid

Description:
5-(3-Fluoro-5-hydroxyphenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261911-98-1, is an organic compound characterized by the presence of a pyridine ring and a phenolic structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of a fluorine atom and a hydroxyl group on the phenyl ring enhances its polarity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of both electron-withdrawing (fluorine) and electron-donating (hydroxyl) groups can affect the compound's electronic properties, solubility, and interaction with biological targets. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical and pharmaceutical research.
Formula:C12H8FNO3
InChI:InChI=1S/C12H8FNO3/c13-10-2-7(3-11(15)4-10)8-1-9(12(16)17)6-14-5-8/h1-6,15H,(H,16,17)
InChI key:InChIKey=VELFZXNONUTYNU-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(O)C1)C=2C=C(C(O)=O)C=NC2
Synonyms:
  • 5-(3-Fluoro-5-hydroxyphenyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(3-fluoro-5-hydroxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.