
CAS 1261912-29-1
:6-(2-Fluoro-4-methoxyphenyl)-3-pyridinol
Description:
6-(2-Fluoro-4-methoxyphenyl)-3-pyridinol, identified by its CAS number 1261912-29-1, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a phenyl group that contains both a fluorine and a methoxy group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the methoxy group may influence the compound's electronic properties and steric hindrance. The hydroxyl group contributes to the compound's polarity and can participate in hydrogen bonding, which is crucial for interactions with biological targets. Overall, the unique combination of functional groups in 6-(2-Fluoro-4-methoxyphenyl)-3-pyridinol suggests that it may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development.
Formula:C12H10FNO2
InChI:InChI=1S/C12H10FNO2/c1-16-9-3-4-10(11(13)6-9)12-5-2-8(15)7-14-12/h2-7,15H,1H3
InChI key:InChIKey=DMGCMSALYJQEQK-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(OC)=C1)C2=CC=C(O)C=N2
Synonyms:- 3-Pyridinol, 6-(2-fluoro-4-methoxyphenyl)-
- 6-(2-Fluoro-4-methoxyphenyl)-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.