CAS 1261912-76-8

5-[3-Fluoro-4-(methoxycarbonyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid

Description:

5-[3-Fluoro-4-(methoxycarbonyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. The presence of a fluorine atom and a methoxycarbonyl group on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is likely to exhibit polar characteristics due to the carboxylic acid and methoxy groups, influencing its solubility in various solvents. The fluorine substituent can enhance lipophilicity and may affect the compound's biological activity. Additionally, the methoxy group can participate in hydrogen bonding, impacting the compound's interaction with biological targets. Overall, this compound's structural features suggest potential utility in drug development, particularly in the design of pharmaceuticals targeting specific biological pathways. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or reference to literature for precise characterization.

Formula: C₁₅H₁₂FNO₅

InChI: InChI=1S/C15H12FNO5/c1-21-13-11(14(18)19)5-9(7-17-13)8-3-4-10(12(16)6-8)15(20)22-2/h3-7H,1-2H3,(H,18,19)

InChI key: InChIKey=OTLBFHUKIMSXKL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1OC)C2=CC(F)=C(C(OC)=O)C=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-[3-fluoro-4-(methoxycarbonyl)phenyl]-2-methoxy-
• 5-[3-Fluoro-4-(methoxycarbonyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid