CAS 1261912-94-0

2-(4-Methoxy-2-methylphenyl)-3-pyridinecarboxylic acid

Description:

2-(4-Methoxy-2-methylphenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261912-94-0, is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring and a carboxylic acid functional group. This compound features a methoxy group and a methyl group on a phenyl ring, contributing to its potential biological activity and solubility properties. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to various pharmacological activities. However, specific applications and biological effects would require further investigation through experimental studies.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-9-8-10(18-2)5-6-11(9)13-12(14(16)17)4-3-7-15-13/h3-8H,1-2H3,(H,16,17)

InChI key: InChIKey=LAOIMBHGFVDLEF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N=CC=C1)C2=C(C)C=C(OC)C=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 2-(4-methoxy-2-methylphenyl)-
• 2-(4-Methoxy-2-methylphenyl)-3-pyridinecarboxylic acid