CAS 1261913-02-3

3-Methyl 4,4′-difluoro[1,1′-biphenyl]-3,3′-dicarboxylate

Description:

3-Methyl 4,4′-difluoro[1,1′-biphenyl]-3,3′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two carboxylate groups (dicarboxylate) indicates that it can participate in various chemical reactions, particularly in esterification and as a potential ligand in coordination chemistry. The methyl and difluoro substituents contribute to its unique electronic and steric properties, potentially influencing its reactivity and solubility. The difluoro groups can enhance the compound's lipophilicity and may affect its interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in materials science, particularly in the development of organic semiconductors or polymers. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they are influenced by the molecular structure and substituents. Overall, this compound represents a versatile structure with potential applications across various fields of chemistry.

Formula: C₁₅H₁₀F₂O₄

InChI: InChI=1S/C15H10F2O4/c1-21-15(20)11-7-9(3-5-13(11)17)8-2-4-12(16)10(6-8)14(18)19/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=WXOAAFAZSLMFMV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=CC1F)C2=CC(C(O)=O)=C(F)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,3′-dicarboxylic acid, 4,4′-difluoro-, 3-methyl ester
• 3-Methyl 4,4′-difluoro[1,1′-biphenyl]-3,3′-dicarboxylate