CAS 1261913-10-3

3′-(Methylsulfonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-(Methylsulfonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a methylsulfonyl group, a nitro group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as potential acidity due to the carboxylic acid group and the ability to participate in hydrogen bonding. The presence of the nitro group often imparts additional reactivity, making it a candidate for various chemical reactions, including electrophilic substitution. The methylsulfonyl group can enhance solubility in polar solvents and may influence the compound's biological activity. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique functional groups and structural features, which can affect its interactions in biological systems and its utility in synthetic applications.

Formula: C₁₄H₁₁NO₆S

InChI: InChI=1S/C14H11NO6S/c1-22(20,21)13-4-2-3-9(8-13)10-5-11(14(16)17)7-12(6-10)15(18)19/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=HAICSSQILPAAHZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC(S(C)(=O)=O)=CC=C2

Synonyms:

• 3′-(Methylsulfonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 3′-(methylsulfonyl)-5-nitro-