CymitQuimica logo

CAS 1261913-22-7

:

4′-(Ethylthio)-3-fluoro[1,1′-biphenyl]-4-carboxylic acid

Description:
4′-(Ethylthio)-3-fluoro[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The ethylthio group (-S-ethyl) introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility. The fluorine atom at the 3-position of the biphenyl ring contributes to the compound's electronic properties, potentially enhancing its reactivity and affecting its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for further research in medicinal chemistry. Additionally, its specific functional groups can affect its physical properties, such as melting point, boiling point, and solubility in various solvents. Overall, the combination of these characteristics makes it a compound of interest in both synthetic and applied chemistry contexts.
Formula:C15H13FO2S
InChI:InChI=1S/C15H13FO2S/c1-2-19-12-6-3-10(4-7-12)11-5-8-13(15(17)18)14(16)9-11/h3-9H,2H2,1H3,(H,17,18)
InChI key:InChIKey=QUWNBTRMEIAHJK-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C(O)=O)C2=CC=C(SCC)C=C2
Synonyms:
  • 4′-(Ethylthio)-3-fluoro[1,1′-biphenyl]-4-carboxylic acid
  • [1,1′-Biphenyl]-4-carboxylic acid, 4′-(ethylthio)-3-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.