CAS 1261913-56-7

3′-Chloro-4′-methoxy-5-nitro[1,1′-biphenyl]-2-carboxylic acid

Description:

3′-Chloro-4′-methoxy-5-nitro[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a carboxylic acid group (-COOH), a nitro group (-NO2), a methoxy group (-OCH3), and a chloro substituent (-Cl) on the biphenyl framework. The presence of these groups contributes to its chemical reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The nitro group is known for its electron-withdrawing properties, which can influence the compound's acidity and reactivity. The methoxy group can enhance solubility in organic solvents and may also affect the compound's biological activity. Overall, the unique combination of substituents on the biphenyl core gives this compound distinct chemical properties, making it of interest for further research and development in synthetic chemistry and material science.

Formula: C₁₄H₁₀ClNO₅

InChI: InChI=1S/C14H10ClNO5/c1-21-13-5-2-8(6-12(13)15)11-7-9(16(19)20)3-4-10(11)14(17)18/h2-7H,1H3,(H,17,18)

InChI key: InChIKey=WNAPVMVMCBWXFL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=CC(Cl)=C(OC)C=C2

Synonyms:

• 3′-Chloro-4′-methoxy-5-nitro[1,1′-biphenyl]-2-carboxylic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 3′-chloro-4′-methoxy-5-nitro-