
CAS 1261913-79-4
:2′,3′-Dichloro-5-nitro[1,1′-biphenyl]-2-carboxylic acid
Description:
2′,3′-Dichloro-5-nitro[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine atoms and a nitro group attached to the biphenyl framework, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in different solvents. The dichloro and nitro substituents can enhance the compound's biological activity and may also affect its environmental persistence. As with many chlorinated and nitro compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact. Overall, 2′,3′-Dichloro-5-nitro[1,1′-biphenyl]-2-carboxylic acid is a complex molecule with significant implications in chemical research and application.
Formula:C13H7Cl2NO4
InChI:InChI=1S/C13H7Cl2NO4/c14-11-3-1-2-8(12(11)15)10-6-7(16(19)20)4-5-9(10)13(17)18/h1-6H,(H,17,18)
InChI key:InChIKey=GXJTXBJCCHOZNI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=C(Cl)C(Cl)=CC=C2
Synonyms:- 2′,3′-Dichloro-5-nitro[1,1′-biphenyl]-2-carboxylic acid
- [1,1′-Biphenyl]-2-carboxylic acid, 2′,3′-dichloro-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.