
CAS 1261913-82-9
:2-[4-(Trifluoromethyl)phenyl]-4-pyridinol
Description:
2-[4-(Trifluoromethyl)phenyl]-4-pyridinol, identified by its CAS number 1261913-82-9, is an organic compound characterized by its unique molecular structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the hydroxyl group on the pyridine ring. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's interaction with biological targets. The compound may also exhibit moderate solubility in organic solvents, while its behavior in aqueous environments can vary based on pH and other conditions. Overall, 2-[4-(Trifluoromethyl)phenyl]-4-pyridinol is a compound of interest in various fields, including medicinal chemistry and materials science, due to its distinctive structural features and potential applications.
Formula:C12H8F3NO
InChI:InChI=1S/C12H8F3NO/c13-12(14,15)9-3-1-8(2-4-9)11-7-10(17)5-6-16-11/h1-7H,(H,16,17)
InChI key:InChIKey=OOMGVAIYAKRGIX-UHFFFAOYSA-N
SMILES:OC=1C=C(N=CC1)C2=CC=C(C(F)(F)F)C=C2
Synonyms:- 2-[4-(Trifluoromethyl)phenyl]-4-pyridinol
- 4-Pyridinol, 2-[4-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.