CymitQuimica logo

CAS 1261913-95-4

:

4-Fluoro-3-(2-furanyl)benzoic acid

Description:
4-Fluoro-3-(2-furanyl)benzoic acid is an aromatic compound characterized by the presence of a benzoic acid moiety substituted with a fluorine atom and a furanyl group. The fluorine atom, located at the para position relative to the carboxylic acid group, can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. The furanyl group, derived from furan, contributes to the compound's unique structural and electronic characteristics, which may affect its biological activity and interactions with other molecules. This compound is likely to exhibit moderate to high polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding. Additionally, the presence of both the fluorine and the furan ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, 4-Fluoro-3-(2-furanyl)benzoic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H7FO3
InChI:InChI=1S/C11H7FO3/c12-9-4-3-7(11(13)14)6-8(9)10-2-1-5-15-10/h1-6H,(H,13,14)
InChI key:InChIKey=LKGNRSLLYDNDHY-UHFFFAOYSA-N
SMILES:FC=1C(=CC(C(O)=O)=CC1)C2=CC=CO2
Synonyms:
  • Benzoic acid, 4-fluoro-3-(2-furanyl)-
  • 4-Fluoro-3-(2-furanyl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.