CAS 1261915-32-5

3′-Fluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid

Description:

3′-Fluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 3′ position and two carboxylic acid groups at the 3 and 4′ positions significantly influences its chemical properties. This compound is likely to exhibit strong acidity due to the carboxylic acid functional groups, which can donate protons in solution. The fluorine substituent can enhance the compound's reactivity and polarity, potentially affecting its solubility in various solvents. Additionally, the structural arrangement may lead to interesting electronic properties, making it a candidate for applications in materials science or pharmaceuticals. Its synthesis and characterization would typically involve standard organic chemistry techniques, including functional group transformations and spectroscopic analysis. Overall, 3′-Fluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid represents a versatile compound with potential utility in various chemical applications.

Formula: C₁₄H₉FO₄

InChI: InChI=1S/C14H9FO4/c15-12-7-9(4-5-11(12)14(18)19)8-2-1-3-10(6-8)13(16)17/h1-7H,(H,16,17)(H,18,19)

InChI key: InChIKey=LCIZJJBPQCFJEY-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(O)=O)C2=CC(C(O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 3′-fluoro-
• 3′-Fluoro[1,1′-biphenyl]-3,4′-dicarboxylic acid

3-(4-Carboxy-3-fluorophenyl)benzoic acid

CAS: 1261915-32-5

Formula: C₁₄H₉FO₄

Purity: 95%

Molecular weight: 260.2173

Ref: IN-DA000S64

3′-Fluoro-[1,1′-biphenyl]-3,4′-dicarboxylic acid

CAS: 1261915-32-5

Formula: C₁₄H₉FO₄

Purity: 95.0%

Molecular weight: 260.22

Ref: 10-F217301