CymitQuimica logo

CAS 1261916-33-9

:

4′,5-Difluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
4′,5-Difluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a fluorinated organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of multiple fluorine substituents, specifically at the 4′ and 5′ positions on one phenyl ring and a trifluoromethyl group at the 3′ position on the other, significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 3-position contributes to its acidity and reactivity, allowing for potential interactions in various chemical environments. This compound may exhibit unique characteristics such as enhanced stability and altered solubility due to the electronegative fluorine atoms. Its applications could span across pharmaceuticals, agrochemicals, or materials science, where fluorinated compounds are often sought for their distinctive properties. As with many fluorinated compounds, safety and environmental considerations are essential due to the persistence and potential toxicity of fluorinated substances.
Formula:C14H7F5O2
InChI:InChI=1S/C14H7F5O2/c15-10-4-8(3-9(5-10)13(20)21)7-1-2-12(16)11(6-7)14(17,18)19/h1-6H,(H,20,21)
InChI key:InChIKey=XXEJROWLHVDJNJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(F)C1)C2=CC(C(F)(F)F)=C(F)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′,5-difluoro-3′-(trifluoromethyl)-
  • 4′,5-Difluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.