CAS 1261917-36-5

3-Methyl-5-(1-naphthalenyl)phenol

Description:

3-Methyl-5-(1-naphthalenyl)phenol, identified by its CAS number 1261917-36-5, is an organic compound characterized by its phenolic structure, which includes a methyl group and a naphthyl substituent. This compound features a hydroxyl (-OH) group attached to a phenolic ring, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the naphthyl group enhances its aromatic properties, which can influence its solubility and stability in different solvents. Typically, compounds of this nature exhibit moderate to high melting points and may be solid at room temperature. They can participate in hydrogen bonding due to the hydroxyl group, affecting their interactions with other molecules. Additionally, the compound may exhibit biological activity, making it of interest for further research in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₇H₁₄O

InChI: InChI=1S/C17H14O/c1-12-9-14(11-15(18)10-12)17-8-4-6-13-5-2-3-7-16(13)17/h2-11,18H,1H3

InChI key: InChIKey=PXHROHCWFPWCCF-UHFFFAOYSA-N

SMILES: CC=1C=C(C=2C3=C(C=CC2)C=CC=C3)C=C(O)C1

Synonyms:

• 3-Methyl-5-(1-naphthalenyl)phenol
• Phenol, 3-methyl-5-(1-naphthalenyl)-