CymitQuimica logo

CAS 1261917-52-5

:

5-Chloro-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-2-carboxylic acid

Description:
5-Chloro-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 5-position and a methylsulfonylamino group at the 3′-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 2-position enhances its solubility in polar solvents and may influence its interaction with biological systems. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential for hydrogen bonding and interactions with various biological targets. Additionally, the presence of the sulfonyl group may enhance its metabolic stability. As with many chemical substances, safety and handling precautions are essential, given the potential for toxicity associated with halogenated compounds. Overall, this compound represents a class of molecules that may have significant applications in medicinal chemistry and drug development.
Formula:C14H12ClNO4S
InChI:InChI=1S/C14H12ClNO4S/c1-21(19,20)16-11-4-2-3-9(7-11)13-8-10(15)5-6-12(13)14(17)18/h2-8,16H,1H3,(H,17,18)
InChI key:InChIKey=XMPSRTXOXMUNGY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(Cl)C=C1)C2=CC(NS(C)(=O)=O)=CC=C2
Synonyms:
  • 5-Chloro-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-2-carboxylic acid
  • [1,1′-Biphenyl]-2-carboxylic acid, 5-chloro-3′-[(methylsulfonyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.