CAS 1261917-64-9

5-Chloro-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-2-carboxylic acid

Description:

5-Chloro-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 5-position and a carboxylic acid functional group at the 2-position contributes to its reactivity and solubility properties. The compound also features a pyrrolidinylcarbonyl substituent, which enhances its potential for biological activity, possibly influencing its pharmacological properties. This compound may exhibit various characteristics such as moderate to high lipophilicity due to the biphenyl moiety, and it may participate in hydrogen bonding due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.

Formula: C₁₈H₁₆ClNO₃

InChI: InChI=1S/C18H16ClNO3/c19-14-6-7-15(18(22)23)16(11-14)12-4-3-5-13(10-12)17(21)20-8-1-2-9-20/h3-7,10-11H,1-2,8-9H2,(H,22,23)

InChI key: InChIKey=QYLINSFZJGFCJJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(Cl)C=C1)C2=CC(C(=O)N3CCCC3)=CC=C2

Synonyms:

• 5-Chloro-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-2-carboxylic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 5-chloro-3′-(1-pyrrolidinylcarbonyl)-