
CAS 1261917-69-4
:4′-Methoxy-3-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol
Description:
4′-Methoxy-3-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol, identified by its CAS number 1261917-69-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to the biphenyl framework, along with a hydroxyl group (-OH) at the para position relative to the methoxy group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in various chemical and pharmaceutical applications. The hydroxyl group contributes to its potential as a phenolic compound, which can participate in hydrogen bonding and may exhibit antioxidant properties. Overall, the unique combination of functional groups in this compound suggests potential utility in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and reactivity.
Formula:C15H13F3O2
InChI:InChI=1S/C15H13F3O2/c1-9-7-10(3-5-13(9)19)11-4-6-14(20-2)12(8-11)15(16,17)18/h3-8,19H,1-2H3
InChI key:InChIKey=JQIRTWBXEOSEFT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1OC)C2=CC(C)=C(O)C=C2
Synonyms:- 4′-Methoxy-3-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol
- [1,1′-Biphenyl]-4-ol, 4′-methoxy-3-methyl-3′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.