CAS 1261917-94-5

3′-Amino-4-fluoro[1,1′-biphenyl]-3-ol

Description:

3′-Amino-4-fluoro[1,1′-biphenyl]-3-ol, identified by its CAS number 1261917-94-5, is an organic compound characterized by the presence of an amino group, a hydroxyl group, and a fluorine atom attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, contributing to its stability and potential for various chemical interactions. The amino group (-NH2) is known for its basic properties and ability to participate in hydrogen bonding, while the hydroxyl group (-OH) enhances solubility in polar solvents and also allows for hydrogen bonding. The fluorine atom introduces unique electronic properties, potentially influencing the compound's reactivity and interactions with biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and related fields. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise determination.

Formula: C₁₂H₁₀FNO

InChI: InChI=1S/C12H10FNO/c13-11-5-4-9(7-12(11)15)8-2-1-3-10(14)6-8/h1-7,15H,14H2

InChI key: InChIKey=NXGGSDGPYGOGOU-UHFFFAOYSA-N

SMILES: OC=1C=C(C=CC1F)C2=CC(N)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 3′-amino-4-fluoro-
• 3′-Amino-4-fluoro[1,1′-biphenyl]-3-ol