CymitQuimica logo

CAS 1261917-97-8

:

3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile

Description:
3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 3′ position and a hydroxyl group at the 5′ position contributes to its unique chemical properties, potentially influencing its reactivity and solubility. The carbonitrile functional group at the 3 position adds to its polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting biological activities due to the presence of the hydroxyl and carbonitrile groups, which can interact with biological targets. Its molecular structure suggests potential applications in pharmaceuticals or materials science, although specific applications would depend on further research into its properties and behavior in different environments. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine and the potential toxicity of the carbonitrile group.
Formula:C13H8FNO
InChI:InChI=1S/C13H8FNO/c14-12-5-11(6-13(16)7-12)10-3-1-2-9(4-10)8-15/h1-7,16H
InChI key:InChIKey=NOJQGDSZDYVGCA-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1)C2=CC(F)=CC(O)=C2
Synonyms:
  • 3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-3-carbonitrile
  • [1,1′-Biphenyl]-3-carbonitrile, 3′-fluoro-5′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.