
CAS 1261918-06-2
:4-(3-Fluoro-4-hydroxyphenyl)-2-thiophenecarboxaldehyde
Description:
4-(3-Fluoro-4-hydroxyphenyl)-2-thiophenecarboxaldehyde is an organic compound characterized by its unique functional groups and structural features. It contains a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, and an aldehyde functional group, indicating its potential reactivity in various chemical reactions. The presence of a fluorine atom and a hydroxy group on the phenyl ring contributes to its electronic properties, potentially influencing its reactivity and interactions with other molecules. This compound may exhibit interesting biological activities due to its structural characteristics, making it a subject of interest in medicinal chemistry and material science. Additionally, its specific molecular structure can lead to unique physical properties, such as solubility and melting point, which are important for applications in pharmaceuticals or organic synthesis. Overall, 4-(3-Fluoro-4-hydroxyphenyl)-2-thiophenecarboxaldehyde represents a versatile compound with potential applications in various fields of chemistry.
Formula:C11H7FO2S
InChI:InChI=1S/C11H7FO2S/c12-10-4-7(1-2-11(10)14)8-3-9(5-13)15-6-8/h1-6,14H
InChI key:InChIKey=YZUHEDUVBMBQRS-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CS1)C2=CC(F)=C(O)C=C2
Synonyms:- 2-Thiophenecarboxaldehyde, 4-(3-fluoro-4-hydroxyphenyl)-
- 4-(3-Fluoro-4-hydroxyphenyl)-2-thiophenecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.