CymitQuimica logo

CAS 1261918-31-3

:

6-Chloro-3′-fluoro[1,1′-biphenyl]-3,4′-diol

Description:
6-Chloro-3′-fluoro[1,1′-biphenyl]-3,4′-diol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 6-position and a fluorine atom at the 3′-position introduces halogen substituents that can significantly influence the compound's chemical reactivity and physical properties. Additionally, the presence of hydroxyl groups (-OH) at the 3 and 4′ positions contributes to its potential as a phenolic compound, which may exhibit hydrogen bonding capabilities, affecting solubility and reactivity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features. Its specific interactions, stability, and potential applications would depend on the context of its use, including any biological or environmental implications. As with many halogenated compounds, considerations regarding toxicity and environmental impact are essential in its handling and application.
Formula:C12H8ClFO2
InChI:InChI=1S/C12H8ClFO2/c13-10-3-2-8(15)6-9(10)7-1-4-12(16)11(14)5-7/h1-6,15-16H
InChI key:InChIKey=IBBVBGPEMYQVNM-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(F)=C(O)C=C2)C=C(O)C=C1
Synonyms:
  • [1,1′-Biphenyl]-3,4′-diol, 6-chloro-3′-fluoro-
  • 6-Chloro-3′-fluoro[1,1′-biphenyl]-3,4′-diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.