CymitQuimica logo

CAS 1261918-43-7

:

Methyl 4-(3-fluoro-4-hydroxyphenyl)-2-thiophenecarboxylate

Description:
Methyl 4-(3-fluoro-4-hydroxyphenyl)-2-thiophenecarboxylate is an organic compound characterized by its complex structure, which includes a thiophene ring, a carboxylate group, and a substituted phenolic moiety. The presence of a fluorine atom and a hydroxyl group on the aromatic ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, while the thiophene ring may impart some degree of aromatic stability. The methyl ester functional group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. Additionally, the specific arrangement of substituents can affect the compound's electronic properties, making it a candidate for various applications in drug development and organic synthesis.
Formula:C12H9FO3S
InChI:InChI=1S/C12H9FO3S/c1-16-12(15)11-5-8(6-17-11)7-2-3-10(14)9(13)4-7/h2-6,14H,1H3
InChI key:InChIKey=HQGWLGOVXXTXGV-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CS1)C2=CC(F)=C(O)C=C2
Synonyms:
  • Methyl 4-(3-fluoro-4-hydroxyphenyl)-2-thiophenecarboxylate
  • 2-Thiophenecarboxylic acid, 4-(3-fluoro-4-hydroxyphenyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.