CymitQuimica logo

CAS 1261918-96-0

:

2′-Fluoro-3-hydroxy-4′-methoxy[1,1′-biphenyl]-4-carboxaldehyde

Description:
2′-Fluoro-3-hydroxy-4′-methoxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2′ position and a methoxy group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties, including potential variations in reactivity and solubility. The hydroxyl group at the 3-position and the aldehyde functional group at the 4-position further enhance its reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions or condensation reactions. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, its molecular structure suggests potential applications in fields such as medicinal chemistry, materials science, or as a synthetic intermediate in organic synthesis. Overall, the combination of functional groups and the biphenyl framework makes this compound a subject of interest for further research and application.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c1-18-11-4-5-12(13(15)7-11)9-2-3-10(8-16)14(17)6-9/h2-8,17H,1H3
InChI key:InChIKey=SPXOVGSSVHMDRD-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(OC)=C1)C2=CC(O)=C(C=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxaldehyde, 2′-fluoro-3-hydroxy-4′-methoxy-
  • 2′-Fluoro-3-hydroxy-4′-methoxy[1,1′-biphenyl]-4-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.