CymitQuimica logo

CAS 1261919-04-3

:

3′,5′-Difluoro-4-hydroxy[1,1′-biphenyl]-3-carbonitrile

Description:
3′,5′-Difluoro-4-hydroxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 3′ and 5′ positions of the biphenyl moiety contributes to its unique electronic properties and potential reactivity. The hydroxyl group (-OH) at the 4-position enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its biological activity and interaction with other molecules. Additionally, the carbonitrile group (-C≡N) at the 3-position introduces a polar functional group that can engage in various chemical reactions, including nucleophilic additions and coordination with metal ions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of substituents, which can significantly affect its behavior in different environments.
Formula:C13H7F2NO
InChI:InChI=1S/C13H7F2NO/c14-11-4-9(5-12(15)6-11)8-1-2-13(17)10(3-8)7-16/h1-6,17H
InChI key:InChIKey=NJXQZPSRGSBMCZ-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1O)C2=CC(F)=CC(F)=C2
Synonyms:
  • 5-(3,5-Difluorophenyl)-2-hydroxybenzonitrile
  • [1,1′-Biphenyl]-3-carbonitrile, 3′,5′-difluoro-4-hydroxy-
  • 3′,5′-Difluoro-4-hydroxy[1,1′-biphenyl]-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.