
CAS 1261919-10-1
:5-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-3-carbonitrile
Description:
5-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-3-carbonitrile, identified by its CAS number 1261919-10-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 5-position and a methylthio group (-S-CH3) at the 2′-position contributes to its unique chemical properties, including potential solubility in polar solvents. The carbonitrile functional group (-C≡N) at the 3-position introduces significant reactivity, making it a candidate for various chemical transformations. This compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point and boiling point. Overall, 5-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-3-carbonitrile is of interest in both synthetic organic chemistry and medicinal chemistry due to its functional groups and biphenyl framework.
Formula:C14H11NOS
InChI:InChI=1S/C14H11NOS/c1-17-14-5-3-2-4-13(14)11-6-10(9-15)7-12(16)8-11/h2-8,16H,1H3
InChI key:InChIKey=QWRVNIOQWQHXEY-UHFFFAOYSA-N
SMILES:S(C)C1=C(C=CC=C1)C2=CC(C#N)=CC(O)=C2
Synonyms:- 5-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-3-carbonitrile
- [1,1′-Biphenyl]-3-carbonitrile, 5-hydroxy-2′-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.