
CAS 1261919-36-1
:4-Hydroxy-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxaldehyde
Description:
4-Hydroxy-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a carboxaldehyde group (-CHO) at specific positions on the biphenyl framework, contributing to its reactivity and potential applications in organic synthesis. The presence of a methylsulfonyl group (-SO2CH3) enhances its solubility and may influence its biological activity. The compound is likely to exhibit properties typical of aromatic aldehydes, such as reactivity in nucleophilic addition reactions, and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect its physical properties, such as melting point and solubility in various solvents. Overall, this compound's unique functional groups and biphenyl backbone make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C14H12O4S
InChI:InChI=1S/C14H12O4S/c1-19(17,18)13-4-2-3-10(8-13)11-5-6-14(16)12(7-11)9-15/h2-9,16H,1H3
InChI key:InChIKey=KOLLETRLXICNNV-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1O)C2=CC(S(C)(=O)=O)=CC=C2
Synonyms:- 4-Hydroxy-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxaldehyde
- [1,1′-Biphenyl]-3-carboxaldehyde, 4-hydroxy-3′-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.