
CAS 1261919-52-1
:3′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Description:
3′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position of one of the phenyl rings contributes to its classification as an alcohol. The compound features a methyl group (-CH3) at the 3′ position and a trifluoromethyl group (-CF3) at the 5-position, which significantly influences its chemical properties, including its polarity and reactivity. The trifluoromethyl group is known for imparting unique electronic characteristics, enhancing the compound's lipophilicity and potentially affecting its biological activity. This compound may exhibit interesting properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its structural features. Additionally, the presence of fluorine atoms can enhance stability and alter the compound's interaction with biological systems. Overall, 3′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol represents a complex molecule with diverse potential applications in various fields of chemistry.
Formula:C14H11F3O
InChI:InChI=1S/C14H11F3O/c1-9-3-2-4-10(5-9)11-6-12(14(15,16)17)8-13(18)7-11/h2-8,18H,1H3
InChI key:InChIKey=QESGGCCHHLDLQP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=C(O)C1)C2=CC(C)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 3′-methyl-5-(trifluoromethyl)-
- 3′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.