CymitQuimica logo

CAS 1261919-56-5

:

4′-Methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol

Description:
4′-Methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position contributes to its classification as a phenolic compound, imparting potential antioxidant properties. The methyl group at the 4′ position and the trifluoromethoxy group at the 5-position enhance its lipophilicity and may influence its reactivity and biological activity. The trifluoromethoxy group, in particular, introduces significant electronegativity, which can affect the compound's interaction with biological targets and its overall stability. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique functional groups and structural features. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, 4′-Methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol represents a complex molecule with potential applications in various fields, including materials science and drug development.
Formula:C14H11F3O2
InChI:InChI=1S/C14H11F3O2/c1-9-2-4-10(5-3-9)11-6-12(18)8-13(7-11)19-14(15,16)17/h2-8,18H,1H3
InChI key:InChIKey=LMPNJWPXPWPPEL-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C2=CC=C(C)C=C2)C=C(O)C1
Synonyms:
  • 4′-Methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 4′-methyl-5-(trifluoromethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.