CAS 1261919-73-6

2-(3-Fluoro-5-hydroxyphenyl)-4-pyridinecarboxylic acid

Description:

2-(3-Fluoro-5-hydroxyphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261919-73-6, is a chemical compound characterized by its complex structure that includes a pyridine ring and a phenolic moiety. The presence of a fluorine atom and a hydroxyl group on the phenyl ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. The fluorine substitution may enhance its lipophilicity and alter its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems could be studied through various assays to determine its efficacy and safety profiles.

Formula: C₁₂H₈FNO₃

InChI: InChI=1S/C12H8FNO3/c13-9-3-8(4-10(15)6-9)11-5-7(12(16)17)1-2-14-11/h1-6,15H,(H,16,17)

InChI key: InChIKey=VSEFYTVXZZUPEZ-UHFFFAOYSA-N

SMILES: FC=1C=C(C=C(O)C1)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 2-(3-Fluoro-5-hydroxyphenyl)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-(3-fluoro-5-hydroxyphenyl)-