CymitQuimica logo

CAS 1261919-82-7

:

1-(4′-Chloro-3′-hydroxy[1,1′-biphenyl]-4-yl)ethanone

Description:
1-(4′-Chloro-3′-hydroxy[1,1′-biphenyl]-4-yl)ethanone, with the CAS number 1261919-82-7, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the para position and a hydroxy group at the meta position on one of the phenyl rings contributes to its unique chemical properties. The ethanone functional group indicates that it contains a carbonyl (C=O) adjacent to an ethyl group, which can influence its reactivity and potential applications in organic synthesis. This compound may exhibit various biological activities due to its structural features, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest potential utility in research and development within the fields of pharmaceuticals and materials science.
Formula:C14H11ClO2
InChI:InChI=1S/C14H11ClO2/c1-9(16)10-2-4-11(5-3-10)12-6-7-13(15)14(17)8-12/h2-8,17H,1H3
InChI key:InChIKey=OMVJMXKIZDIUNJ-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1Cl)C2=CC=C(C(C)=O)C=C2
Synonyms:
  • Ethanone, 1-(4′-chloro-3′-hydroxy[1,1′-biphenyl]-4-yl)-
  • 1-(4′-Chloro-3′-hydroxy[1,1′-biphenyl]-4-yl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.