CAS 1261919-94-1

2-(4-Fluoro-2-hydroxyphenyl)-4-pyridinecarboxylic acid

Description:

2-(4-Fluoro-2-hydroxyphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261919-94-1, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a phenolic moiety. The presence of a fluorine atom and a hydroxyl group on the phenyl ring contributes to its unique chemical properties, including potential biological activity. This compound is likely to exhibit polar characteristics due to the hydroxyl and carboxylic acid functional groups, which can engage in hydrogen bonding. The fluorine substitution may enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the structural arrangement suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and solubility would depend on the specific conditions and solvents used. Overall, this compound represents a class of heterocyclic aromatic compounds that may have significant implications in various chemical and biological contexts.

Formula: C₁₂H₈FNO₃

InChI: InChI=1S/C12H8FNO3/c13-8-1-2-9(11(15)6-8)10-5-7(12(16)17)3-4-14-10/h1-6,15H,(H,16,17)

InChI key: InChIKey=QRFYUJGNTRMAKM-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(C(O)=O)=CC=N2)C=CC(F)=C1

Synonyms:

• 4-Pyridinecarboxylic acid, 2-(4-fluoro-2-hydroxyphenyl)-
• 2-(4-Fluoro-2-hydroxyphenyl)-4-pyridinecarboxylic acid

2-(4-Fluoro-2-hydroxyphenyl)isonicotinic acid (~90%)

Controlled Product

CAS: 1261919-94-1

Applications 2-(4-Fluoro-2-hydroxyphenyl)isonicotinic acid

Formula: C₆H₁₁NO₃·HCl

Purity: ~90%

Color and Shape: Neat

Molecular weight: 181.617

Ref: TR-F597293