CAS 1261920-08-4

5-[3-[(Cyclopropylamino)carbonyl]phenyl]-2-methoxy-3-pyridinecarboxylic acid

Description:

5-[3-[(Cyclopropylamino)carbonyl]phenyl]-2-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and a cyclopropylamino substituent. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The cyclopropylamino moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure indicates potential for hydrogen bonding due to the carboxylic acid and amine functionalities, which may affect its reactivity and interactions in various chemical environments. Additionally, the compound's unique arrangement of functional groups may impart specific pharmacological properties, making it a candidate for further research in drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in pharmaceutical applications.

Formula: C₁₇H₁₆N₂O₄

InChI: InChI=1S/C17H16N2O4/c1-23-16-14(17(21)22)8-12(9-18-16)10-3-2-4-11(7-10)15(20)19-13-5-6-13/h2-4,7-9,13H,5-6H2,1H3,(H,19,20)(H,21,22)

InChI key: InChIKey=AHXLNEVFIYJFPI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1OC)C2=CC(C(NC3CC3)=O)=CC=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-[3-[(cyclopropylamino)carbonyl]phenyl]-2-methoxy-
• 5-[3-[(Cyclopropylamino)carbonyl]phenyl]-2-methoxy-3-pyridinecarboxylic acid