
CAS 1261920-53-9
:5-Amino-4′-cyano[1,1′-biphenyl]-3-carboxylic acid
Description:
5-Amino-4′-cyano[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an amino group (-NH2), a cyano group (-CN), and a carboxylic acid group (-COOH) attached to the biphenyl framework, contributing to its reactivity and potential applications in various chemical processes. The presence of the amino group allows for potential interactions in biological systems, while the cyano group can participate in nucleophilic addition reactions. The carboxylic acid group provides acidic properties, making it soluble in polar solvents. This compound may be of interest in pharmaceutical chemistry, materials science, or as an intermediate in organic synthesis. Its unique functional groups suggest potential for diverse applications, including in the development of dyes, agrochemicals, or as a building block for more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c15-8-9-1-3-10(4-2-9)11-5-12(14(17)18)7-13(16)6-11/h1-7H,16H2,(H,17,18)
InChI key:InChIKey=OJNFOEGUTZHFLC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N)C1)C2=CC=C(C#N)C=C2
Synonyms:- 5-Amino-4′-cyano[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 5-amino-4′-cyano-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.