
CAS 1261920-66-4
:4′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a carboxylic acid group (-COOH) contributes to its chemical reactivity and polarity. The fluoro substituent at the 5-position enhances its electronic properties, potentially influencing its behavior in various chemical reactions and applications. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the biphenyl structure may impart some hydrophobic characteristics. It may be utilized in organic synthesis, pharmaceuticals, or materials science, particularly in the development of functionalized polymers or as an intermediate in the synthesis of more complex molecules. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, its unique functional groups and structural features make it a compound of interest in various chemical research fields.
Formula:C14H8FNO2
InChI:InChI=1S/C14H8FNO2/c15-13-6-11(5-12(7-13)14(17)18)10-3-1-9(8-16)2-4-10/h1-7H,(H,17,18)
InChI key:InChIKey=LCAXPLYBKOELCI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(F)C1)C2=CC=C(C#N)C=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 4′-cyano-5-fluoro-
- 4′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.