
CAS 1261920-93-7
:2′-Chloro-4′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Description:
2′-Chloro-4′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a hydroxyl group (-OH) at the 3-position, a chlorine atom at the 2′ position, a methyl group at the 4′ position, and a trifluoromethyl group (-CF3) at the 5-position of the biphenyl moiety. The presence of these substituents contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. The trifluoromethyl group is known to enhance the compound's stability and influence its reactivity, while the hydroxyl group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications and the biological activity associated with similar structures.
Formula:C14H10ClF3O
InChI:InChI=1S/C14H10ClF3O/c1-8-2-3-12(13(15)4-8)9-5-10(14(16,17)18)7-11(19)6-9/h2-7,19H,1H3
InChI key:InChIKey=BRMLTDUGNFVYHA-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(C)=C1)C2=CC(C(F)(F)F)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 2′-chloro-4′-methyl-5-(trifluoromethyl)-
- 2′-Chloro-4′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.