CymitQuimica logo

CAS 1261921-03-2

:

2-Amino-5-[3-chloro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid

Description:
2-Amino-5-[3-chloro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. This substance features an amino group (-NH2), a carboxylic acid group (-COOH), and a methoxycarbonyl group (-COOCH3), contributing to its potential as a bioactive molecule. The presence of the chloro substituent on the phenyl ring enhances its reactivity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the presence of both amino and carboxylic acid functional groups, which can engage in hydrogen bonding. Its solubility in polar solvents is expected, while its stability may vary depending on environmental conditions such as pH and temperature. The compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential applications in medicinal chemistry.
Formula:C14H11ClN2O4
InChI:InChI=1S/C14H11ClN2O4/c1-21-14(20)8-3-2-7(4-11(8)15)10-6-17-12(16)5-9(10)13(18)19/h2-6H,1H3,(H2,16,17)(H,18,19)
InChI key:InChIKey=HHDZOOGCYLJFQA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=C(N)C1)C2=CC(Cl)=C(C(OC)=O)C=C2
Synonyms:
  • 2-Amino-5-[3-chloro-4-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid
  • 4-Pyridinecarboxylic acid, 2-amino-5-[3-chloro-4-(methoxycarbonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.