
CAS 1261921-88-3
:1,2-Dihydro-5-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxo-3-pyridinecarboxylic acid
Description:
1,2-Dihydro-5-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and various functional groups. The presence of a methoxy group and a trifluoromethyl group on the phenyl ring contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The trifluoromethyl group is known to enhance metabolic stability and bioactivity, making this compound of interest in medicinal chemistry. Additionally, the compound's solubility, reactivity, and stability can be influenced by the presence of these substituents, which may also affect its interactions with biological targets. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.
Formula:C14H10F3NO4
InChI:InChI=1S/C14H10F3NO4/c1-22-11-3-2-7(5-10(11)14(15,16)17)8-4-9(13(20)21)12(19)18-6-8/h2-6H,1H3,(H,18,19)(H,20,21)
InChI key:InChIKey=QHCRXWSQLXDENR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(OC)C=CC(=C1)C=2C=C(C(O)=O)C(=O)NC2
Synonyms:- 3-Pyridinecarboxylic acid, 1,2-dihydro-5-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxo-
- 1,2-Dihydro-5-[4-methoxy-3-(trifluoromethyl)phenyl]-2-oxo-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.