
CAS 1261921-99-6
:2′,3-Dichloro-5′-hydroxy[1,1′-biphenyl]-4-carboxylic acid
Description:
2′,3-Dichloro-5′-hydroxy[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine substituents at the 2 and 3 positions of one phenyl ring, a hydroxyl group at the 5′ position, and a carboxylic acid group at the 4 position of the other phenyl ring. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. The dichloro and hydroxy groups can influence the compound's biological activity, making it of interest in fields such as medicinal chemistry and environmental science. Additionally, the carboxylic acid group can participate in acid-base reactions, while the hydroxyl group can engage in hydrogen bonding. Overall, this compound's unique structural features may lead to diverse applications, including potential uses in pharmaceuticals or as intermediates in organic synthesis.
Formula:C13H8Cl2O3
InChI:InChI=1S/C13H8Cl2O3/c14-11-4-2-8(16)6-10(11)7-1-3-9(13(17)18)12(15)5-7/h1-6,16H,(H,17,18)
InChI key:InChIKey=CUAWQWHBXDVNGY-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(Cl)=C(C(O)=O)C=C2)C=C(O)C=C1
Synonyms:- 2′,3-Dichloro-5′-hydroxy[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 2′,3-dichloro-5′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.