
CAS 1261922-30-8
:3-Chloro-2′-(phenylmethoxy)[1,1′-biphenyl]-4-ol
Description:
3-Chloro-2′-(phenylmethoxy)[1,1′-biphenyl]-4-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 4-position of the biphenyl framework contributes to its potential as a phenolic compound, influencing its reactivity and solubility in various solvents. The chlorine substituent at the 3-position and the phenylmethoxy group at the 2′-position further modify its chemical properties, potentially enhancing its lipophilicity and biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of both electron-withdrawing (chlorine) and electron-donating (methoxy) groups can affect its electronic properties, influencing its reactivity in chemical reactions. Overall, 3-Chloro-2′-(phenylmethoxy)[1,1′-biphenyl]-4-ol represents a complex organic molecule with diverse potential applications in research and industry.
Formula:C19H15ClO2
InChI:InChI=1S/C19H15ClO2/c20-17-12-15(10-11-18(17)21)16-8-4-5-9-19(16)22-13-14-6-2-1-3-7-14/h1-12,21H,13H2
InChI key:InChIKey=YRVZBVDYPOOIOF-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C=CC=C2)C3=CC(Cl)=C(O)C=C3
Synonyms:- 3-Chloro-2′-(phenylmethoxy)[1,1′-biphenyl]-4-ol
- [1,1′-Biphenyl]-4-ol, 3-chloro-2′-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.