
CAS 1261922-47-7
:3′-(1-Pyrrolidinylsulfonyl)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Description:
3′-(1-Pyrrolidinylsulfonyl)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a trifluoromethoxy group and a pyrrolidinylsulfonyl moiety. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl, contributing to its potential as a bioactive molecule. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its pharmacokinetic properties. The pyrrolidinylsulfonyl group can impart specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's unique functional groups suggest potential applications in drug development, particularly in areas requiring modulation of biological pathways. Its CAS number, 1261922-47-7, allows for precise identification in chemical databases. As with many synthetic compounds, its stability, solubility, and reactivity would depend on the specific conditions under which it is handled. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H16F3NO4S
InChI:InChI=1S/C17H16F3NO4S/c18-17(19,20)25-15-9-13(8-14(22)11-15)12-4-3-5-16(10-12)26(23,24)21-6-1-2-7-21/h3-5,8-11,22H,1-2,6-7H2
InChI key:InChIKey=HTHUCZBNDAXESZ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C(C=CC1)C2=CC(OC(F)(F)F)=CC(O)=C2)N3CCCC3
Synonyms:- [1,1′-Biphenyl]-3-ol, 3′-(1-pyrrolidinylsulfonyl)-5-(trifluoromethoxy)-
- 3′-(1-Pyrrolidinylsulfonyl)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.