
CAS 1261922-75-1
:4′-Hydroxy-3′-nitro[1,1′-biphenyl]-2-carboxaldehyde
Description:
4′-Hydroxy-3′-nitro[1,1′-biphenyl]-2-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a nitro group (-NO2) at the para and meta positions, respectively, relative to the biphenyl linkage, along with an aldehyde functional group (-CHO) at the second position of the biphenyl. The presence of these functional groups contributes to its chemical reactivity and potential applications in organic synthesis and materials science. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the nitro group can serve as an electron-withdrawing group, influencing the compound's electronic properties. Additionally, the aldehyde group can undergo various reactions, including oxidation and condensation. Overall, this compound's unique structure and functional groups make it of interest in fields such as pharmaceuticals, agrochemicals, and dye chemistry.
Formula:C13H9NO4
InChI:InChI=1S/C13H9NO4/c15-8-10-3-1-2-4-11(10)9-5-6-13(16)12(7-9)14(17)18/h1-8,16H
InChI key:InChIKey=VAOPEMGNEXKUPD-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C2=CC(N(=O)=O)=C(O)C=C2)C=CC=C1
Synonyms:- [1,1′-Biphenyl]-2-carboxaldehyde, 4′-hydroxy-3′-nitro-
- 4′-Hydroxy-3′-nitro[1,1′-biphenyl]-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.