CAS 1261923-14-1

4′-Acetyl-5-fluoro[1,1′-biphenyl]-3-carboxylic acid

Description:

4′-Acetyl-5-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an acetyl group at the para position and a carboxylic acid group at the meta position relative to the fluorine substituent contributes to its chemical reactivity and potential applications in pharmaceuticals or agrochemicals. The fluorine atom enhances the compound's lipophilicity and may influence its biological activity. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the presence of both hydrophobic and hydrophilic functional groups. Its molecular structure suggests potential for hydrogen bonding due to the carboxylic acid group, which may affect its interaction with biological targets. As with many fluorinated compounds, it may exhibit unique properties such as increased stability and altered metabolic pathways. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₅H₁₁FO₃

InChI: InChI=1S/C15H11FO3/c1-9(17)10-2-4-11(5-3-10)12-6-13(15(18)19)8-14(16)7-12/h2-8H,1H3,(H,18,19)

InChI key: InChIKey=VNQGPIZASSATPN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(F)C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• 4′-Acetyl-5-fluoro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4′-acetyl-5-fluoro-