CymitQuimica logo

CAS 1261924-26-8

:

5-[4-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyrimidinone

Description:
5-[4-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyrimidinone, identified by its CAS number 1261924-26-8, is a chemical compound that features a pyrimidinone core substituted with a phenyl group that contains a pyrrolidinylsulfonyl moiety. This structure suggests that the compound may exhibit significant biological activity, potentially interacting with various biological targets due to the presence of the sulfonamide and pyrrolidine functionalities. The sulfonyl group can enhance solubility and bioavailability, while the pyrimidinone structure may contribute to its pharmacological properties. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific diseases. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. As with many compounds in this class, understanding its reactivity, stability, and interaction with biological systems would be crucial for its application in drug development.
Formula:C14H15N3O3S
InChI:InChI=1S/C14H15N3O3S/c18-14-15-9-12(10-16-14)11-3-5-13(6-4-11)21(19,20)17-7-1-2-8-17/h3-6,9-10H,1-2,7-8H2,(H,15,16,18)
InChI key:InChIKey=LYNUJKRWBIFKSQ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(C=C1)C2=CNC(=O)N=C2)N3CCCC3
Synonyms:
  • 2(1H)-Pyrimidinone, 5-[4-(1-pyrrolidinylsulfonyl)phenyl]-
  • 5-[4-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyrimidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.